C11H13IO — CID 139959906
2,5-diethylbenzoyl iodide (PubChem CID 139959906) has the molecular formula C11H13IO and a molecular weight of 288.13 g/mol. Its IUPAC name is 2,5-diethylbenzoyl iodide.
| Compound Name | 2,5-diethylbenzoyl iodide |
|---|---|
| PubChem CID | 139959906 |
| Molecular Formula | C11H13IO |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2,5-diethylbenzoyl iodide |
| SMILES | CCc1ccc(CC)c(C(=O)I)c1 |
| InChI | InChI=1S/C11H13IO/c1-3-8-5-6-9(4-2)10(7-8)11(12)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | JJWCLMVHXYNKDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|