C22H26O3 — CID 150438529
(2,5-diethylbenzoyl) 2,5-diethylbenzoate (PubChem CID 150438529) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2,5-diethylbenzoyl) 2,5-diethylbenzoate.
| Compound Name | (2,5-diethylbenzoyl) 2,5-diethylbenzoate |
|---|---|
| PubChem CID | 150438529 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2,5-diethylbenzoyl) 2,5-diethylbenzoate |
| SMILES | CCc1ccc(CC)c(C(=O)OC(=O)c2cc(CC)ccc2CC)c1 |
| InChI | InChI=1S/C22H26O3/c1-5-15-9-11-17(7-3)19(13-15)21(23)25-22(24)20-14-16(6-2)10-12-18(20)8-4/h9-14H,5-8H2,1-4H3 |
| InChIKey | HLGXWJONDSXOJD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|