C16H22O — CID 107000766
(2,5-diethylphenyl)-(2,2-dimethylcyclopropyl)methanone (PubChem CID 107000766) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (2,5-diethylphenyl)-(2,2-dimethylcyclopropyl)methanone.
| Compound Name | (2,5-diethylphenyl)-(2,2-dimethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 107000766 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2,5-diethylphenyl)-(2,2-dimethylcyclopropyl)methanone |
| SMILES | CCc1ccc(CC)c(C(=O)C2CC2(C)C)c1 |
| InChI | InChI=1S/C16H22O/c1-5-11-7-8-12(6-2)13(9-11)15(17)14-10-16(14,3)4/h7-9,14H,5-6,10H2,1-4H3 |
| InChIKey | NOUWOUVVFBTINP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |