C23H24O5S2 — CID 139696741
2,4-bis[(4-ethylphenyl)sulfonyl]-5-methylphenol (PubChem CID 139696741) has the molecular formula C23H24O5S2 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2,4-bis[(4-ethylphenyl)sulfonyl]-5-methylphenol.
| Compound Name | 2,4-bis[(4-ethylphenyl)sulfonyl]-5-methylphenol |
|---|---|
| PubChem CID | 139696741 |
| Molecular Formula | C23H24O5S2 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2,4-bis[(4-ethylphenyl)sulfonyl]-5-methylphenol |
| SMILES | CCc1ccc(S(=O)(=O)c2cc(S(=O)(=O)c3ccc(CC)cc3)c(O)cc2C)cc1 |
| InChI | InChI=1S/C23H24O5S2/c1-4-17-6-10-19(11-7-17)29(25,26)22-15-23(21(24)14-16(22)3)30(27,28)20-12-8-18(5-2)9-13-20/h6-15,24H,4-5H2,1-3H3 |
| InChIKey | KUVFAOLWPSDFKA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |