C22H22O5S2 — CID 139696742
5-ethyl-2,4-bis[(2-methylphenyl)sulfonyl]phenol (PubChem CID 139696742) has the molecular formula C22H22O5S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 5-ethyl-2,4-bis[(2-methylphenyl)sulfonyl]phenol.
| Compound Name | 5-ethyl-2,4-bis[(2-methylphenyl)sulfonyl]phenol |
|---|---|
| PubChem CID | 139696742 |
| Molecular Formula | C22H22O5S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-ethyl-2,4-bis[(2-methylphenyl)sulfonyl]phenol |
| SMILES | CCc1cc(O)c(S(=O)(=O)c2ccccc2C)cc1S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C22H22O5S2/c1-4-17-13-18(23)22(29(26,27)20-12-8-6-10-16(20)3)14-21(17)28(24,25)19-11-7-5-9-15(19)2/h5-14,23H,4H2,1-3H3 |
| InChIKey | FVZCADCETSHPRT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |