C9H8Br2O — CID 139724573
2,3-dibromo-4-prop-2-enylphenol (PubChem CID 139724573) has the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. Its IUPAC name is 2,3-dibromo-4-prop-2-enylphenol.
| Compound Name | 2,3-dibromo-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 139724573 |
| Molecular Formula | C9H8Br2O |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | 2,3-dibromo-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(Br)c1Br |
| InChI | InChI=1S/C9H8Br2O/c1-2-3-6-4-5-7(12)9(11)8(6)10/h2,4-5,12H,1,3H2 |
| InChIKey | ZYFFTWWFJXMBGU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|