C27H26O3 — CID 146318695
3,4-bis(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol (PubChem CID 146318695) has the molecular formula C27H26O3 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3,4-bis(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol.
| Compound Name | 3,4-bis(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol |
|---|---|
| PubChem CID | 146318695 |
| Molecular Formula | C27H26O3 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 3,4-bis(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol |
| SMILES | C=CCc1cc(-c2ccc(O)c(CC=C)c2-c2ccc(O)c(CC=C)c2)ccc1O |
| InChI | InChI=1S/C27H26O3/c1-4-7-19-16-18(10-13-24(19)28)22-12-15-26(30)23(9-6-3)27(22)21-11-14-25(29)20(17-21)8-5-2/h4-6,10-17,28-30H,1-3,7-9H2 |
| InChIKey | PTVJKHKGRIYUFF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|