C27H26O — CID 121483228
2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol (PubChem CID 121483228) has the molecular formula C27H26O and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol.
| Compound Name | 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol |
|---|---|
| PubChem CID | 121483228 |
| Molecular Formula | C27H26O |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol |
| SMILES | C=CCc1cc(CC=C)c(-c2ccccc2O)c(CC=C)c1-c1ccccc1 |
| InChI | InChI=1S/C27H26O/c1-4-12-21-19-22(13-5-2)27(23-17-10-11-18-25(23)28)24(14-6-3)26(21)20-15-8-7-9-16-20/h4-11,15-19,28H,1-3,12-14H2 |
| InChIKey | PISPTYJUALYGRV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|