About 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol
2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol (PubChem CID 121483228) has the molecular formula C27H26O
and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol.
Molecular Properties
| Compound Name | 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol |
| PubChem CID | 121483228 |
| Molecular Formula | C27H26O |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol |
| SMILES | C=CCc1cc(CC=C)c(-c2ccccc2O)c(CC=C)c1-c1ccccc1 |
| InChI | InChI=1S/C27H26O/c1-4-12-21-19-22(13-5-2)27(23-17-10-11-18-25(23)28)24(14-6-3)26(21)20-15-8-7-9-16-20/h4-11,15-19,28H,1-3,12-14H2 |
| InChIKey | PISPTYJUALYGRV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol?
The IUPAC name of 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol (CID 121483228) is 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol.
What is the SMILES notation for 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol?
The canonical SMILES for 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol is C=CCc1cc(CC=C)c(-c2ccccc2O)c(CC=C)c1-c1ccccc1.
What is the InChIKey of 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol?
The InChIKey is PISPTYJUALYGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26O/c1-4-12-21-19-22(13-5-2)27(23-17-10-11-18-25(23)28)24(14-6-3)26(21)20-15-8-7-9-16-20/h4-11,15-19,28H,1-3,12-14H2.
What are the key properties of 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol?
2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol has a molecular weight of 366.50 g/mol, XLogP of 6.91, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-phenyl-2,4,6-tris(prop-2-enyl)phenyl]phenol is sourced from PubChem (CID 121483228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).