C22H20N2O2 — CID 136928051
N',2-dihydroxy-5,6-diphenyl-3-prop-2-enylbenzenecarboximidamide (PubChem CID 136928051) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is N',2-dihydroxy-5,6-diphenyl-3-prop-2-enylbenzenecarboximidamide.
| Compound Name | N',2-dihydroxy-5,6-diphenyl-3-prop-2-enylbenzenecarboximidamide |
|---|---|
| PubChem CID | 136928051 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N',2-dihydroxy-5,6-diphenyl-3-prop-2-enylbenzenecarboximidamide |
| SMILES | C=CCc1cc(-c2ccccc2)c(-c2ccccc2)c(/C(N)=N/O)c1O |
| InChI | InChI=1S/C22H20N2O2/c1-2-9-17-14-18(15-10-5-3-6-11-15)19(16-12-7-4-8-13-16)20(21(17)25)22(23)24-26/h2-8,10-14,25-26H,1,9H2,(H2,23,24) |
| InChIKey | SNBBTFFRYZDXBA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|