C10H12N2O2 — CID 165345619
N',2-dihydroxy-3-prop-2-enylbenzenecarboximidamide (PubChem CID 165345619) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N',2-dihydroxy-3-prop-2-enylbenzenecarboximidamide.
| Compound Name | N',2-dihydroxy-3-prop-2-enylbenzenecarboximidamide |
|---|---|
| PubChem CID | 165345619 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N',2-dihydroxy-3-prop-2-enylbenzenecarboximidamide |
| SMILES | C=CCc1cccc(/C(N)=N/O)c1O |
| InChI | InChI=1S/C10H12N2O2/c1-2-4-7-5-3-6-8(9(7)13)10(11)12-14/h2-3,5-6,13-14H,1,4H2,(H2,11,12) |
| InChIKey | XXVFINRWDPEOSZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|