C7H8N2O4 — CID 137272407
N',2,3,4-tetrahydroxybenzenecarboximidamide (PubChem CID 137272407) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is N',2,3,4-tetrahydroxybenzenecarboximidamide.
| Compound Name | N',2,3,4-tetrahydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 137272407 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N',2,3,4-tetrahydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C7H8N2O4/c8-7(9-13)3-1-2-4(10)6(12)5(3)11/h1-2,10-13H,(H2,8,9) |
| InChIKey | YPDCARQCUJAWLA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|