C12H12N4O4 — CID 135496562
2-N',3-N',1,4-tetrahydroxynaphthalene-2,3-dicarboximidamide (PubChem CID 135496562) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-N',3-N',1,4-tetrahydroxynaphthalene-2,3-dicarboximidamide.
| Compound Name | 2-N',3-N',1,4-tetrahydroxynaphthalene-2,3-dicarboximidamide |
|---|---|
| PubChem CID | 135496562 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-N',3-N',1,4-tetrahydroxynaphthalene-2,3-dicarboximidamide |
| SMILES | NC(=NO)c1c(C(N)=NO)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C12H12N4O4/c13-11(15-19)7-8(12(14)16-20)10(18)6-4-2-1-3-5(6)9(7)17/h1-4,17-20H,(H2,13,15)(H2,14,16) |
| InChIKey | NIPPUSPNWIZRLR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|