C8H7N3O2 — CID 136969995
N'-hydroxy-1,2-benzoxazole-3-carboximidamide (PubChem CID 136969995) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is N'-hydroxy-1,2-benzoxazole-3-carboximidamide.
| Compound Name | N'-hydroxy-1,2-benzoxazole-3-carboximidamide |
|---|---|
| PubChem CID | 136969995 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | N'-hydroxy-1,2-benzoxazole-3-carboximidamide |
| SMILES | N/C(=N\O)c1noc2ccccc12 |
| InChI | InChI=1S/C8H7N3O2/c9-8(10-12)7-5-3-1-2-4-6(5)13-11-7/h1-4,12H,(H2,9,10) |
| InChIKey | IWGRMAJVPQEKDI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|