C17H15NO2 — CID 67605423
3-(1,2-benzoxazol-3-yl)-1-phenylbut-3-en-1-ol (PubChem CID 67605423) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-(1,2-benzoxazol-3-yl)-1-phenylbut-3-en-1-ol.
| Compound Name | 3-(1,2-benzoxazol-3-yl)-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 67605423 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(1,2-benzoxazol-3-yl)-1-phenylbut-3-en-1-ol |
| SMILES | C=C(CC(O)c1ccccc1)c1noc2ccccc12 |
| InChI | InChI=1S/C17H15NO2/c1-12(11-15(19)13-7-3-2-4-8-13)17-14-9-5-6-10-16(14)20-18-17/h2-10,15,19H,1,11H2 |
| InChIKey | DDZWXZAXTNQXJM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |