C18H13BrN2O4 — CID 161245986
1-(1,2-benzoxazol-3-yl)-2-bromoethanone;1-(1,2-benzoxazol-3-yl)ethanone (PubChem CID 161245986) has the molecular formula C18H13BrN2O4 and a molecular weight of 401.22 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-2-bromoethanone;1-(1,2-benzoxazol-3-yl)ethanone.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-2-bromoethanone;1-(1,2-benzoxazol-3-yl)ethanone |
|---|---|
| PubChem CID | 161245986 |
| Molecular Formula | C18H13BrN2O4 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-2-bromoethanone;1-(1,2-benzoxazol-3-yl)ethanone |
| SMILES | CC(=O)c1noc2ccccc12.O=C(CBr)c1noc2ccccc12 |
| InChI | InChI=1S/C9H6BrNO2.C9H7NO2/c10-5-7(12)9-6-3-1-2-4-8(6)13-11-9;1-6(11)9-7-4-2-3-5-8(7)12-10-9/h1-4H,5H2;2-5H,1H3 |
| InChIKey | VAQKZPPTZOMPBB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|