About 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate
2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate (PubChem CID 10402407) has the molecular formula C12H14N2O5S
and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate |
| PubChem CID | 10402407 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate |
| SMILES | CN(CCOS(C)(=O)=O)C(=O)c1noc2ccccc12 |
| InChI | InChI=1S/C12H14N2O5S/c1-14(7-8-18-20(2,16)17)12(15)11-9-5-3-4-6-10(9)19-13-11/h3-6H,7-8H2,1-2H3 |
| InChIKey | NTEMUGGCVBIDBJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate?
The IUPAC name of 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate (CID 10402407) is 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate.
What is the SMILES notation for 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate?
The canonical SMILES for 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate is CN(CCOS(C)(=O)=O)C(=O)c1noc2ccccc12.
What is the InChIKey of 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate?
The InChIKey is NTEMUGGCVBIDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5S/c1-14(7-8-18-20(2,16)17)12(15)11-9-5-3-4-6-10(9)19-13-11/h3-6H,7-8H2,1-2H3.
What are the key properties of 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate?
2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate has a molecular weight of 298.32 g/mol, XLogP of 0.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,2-benzoxazole-3-carbonyl(methyl)amino]ethyl methanesulfonate is sourced from PubChem (CID 10402407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).