C13H9N3O2 — CID 167437414
(2-amino-4-pyridinyl)-(1,2-benzoxazol-3-yl)methanone (PubChem CID 167437414) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2-amino-4-pyridinyl)-(1,2-benzoxazol-3-yl)methanone.
| Compound Name | (2-amino-4-pyridinyl)-(1,2-benzoxazol-3-yl)methanone |
|---|---|
| PubChem CID | 167437414 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (2-amino-4-pyridinyl)-(1,2-benzoxazol-3-yl)methanone |
| SMILES | Nc1cc(C(=O)c2noc3ccccc23)ccn1 |
| InChI | InChI=1S/C13H9N3O2/c14-11-7-8(5-6-15-11)13(17)12-9-3-1-2-4-10(9)18-16-12/h1-7H,(H2,14,15) |
| InChIKey | XUYPSUVEFDUKAV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |