C11H11NO2S — CID 166506534
S-[2-(1,2-benzoxazol-3-yl)ethyl] ethanethioate (PubChem CID 166506534) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is S-[2-(1,2-benzoxazol-3-yl)ethyl] ethanethioate.
| Compound Name | S-[2-(1,2-benzoxazol-3-yl)ethyl] ethanethioate |
|---|---|
| PubChem CID | 166506534 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | S-[2-(1,2-benzoxazol-3-yl)ethyl] ethanethioate |
| SMILES | CC(=O)SCCc1noc2ccccc12 |
| InChI | InChI=1S/C11H11NO2S/c1-8(13)15-7-6-10-9-4-2-3-5-11(9)14-12-10/h2-5H,6-7H2,1H3 |
| InChIKey | FPDSNXVDQPRUOV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|