C11H12N2O2 — CID 57368784
2-ethyl-N'-hydroxy-1-benzofuran-3-carboximidamide (PubChem CID 57368784) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-ethyl-N'-hydroxy-1-benzofuran-3-carboximidamide.
| Compound Name | 2-ethyl-N'-hydroxy-1-benzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 57368784 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-ethyl-N'-hydroxy-1-benzofuran-3-carboximidamide |
| SMILES | CCc1oc2ccccc2c1C(N)=NO |
| InChI | InChI=1S/C11H12N2O2/c1-2-8-10(11(12)13-14)7-5-3-4-6-9(7)15-8/h3-6,14H,2H2,1H3,(H2,12,13) |
| InChIKey | ANLQQUZJPSPFMR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|