C18H14I2O3 — CID 10602323
1-(2-ethyl-1-benzofuran-3-yl)-2-(4-hydroxy-3,5-diiodophenyl)ethanone (PubChem CID 10602323) has the molecular formula C18H14I2O3 and a molecular weight of 532.12 g/mol. Its IUPAC name is 1-(2-ethyl-1-benzofuran-3-yl)-2-(4-hydroxy-3,5-diiodophenyl)ethanone.
| Compound Name | 1-(2-ethyl-1-benzofuran-3-yl)-2-(4-hydroxy-3,5-diiodophenyl)ethanone |
|---|---|
| PubChem CID | 10602323 |
| Molecular Formula | C18H14I2O3 |
| Molecular Weight | 532.12 g/mol |
| Exact Mass | 531.90 |
| IUPAC Name | 1-(2-ethyl-1-benzofuran-3-yl)-2-(4-hydroxy-3,5-diiodophenyl)ethanone |
| SMILES | CCc1oc2ccccc2c1C(=O)Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C18H14I2O3/c1-2-15-17(11-5-3-4-6-16(11)23-15)14(21)9-10-7-12(19)18(22)13(20)8-10/h3-8,22H,2,9H2,1H3 |
| InChIKey | VUMXLYNAVGDQKY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|