C31H16Br6O7 — CID 169438137
[2,6-dibromo-4-[2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]carbonylphenyl] 3,5-dibromo-4-hydroxybenzoate (PubChem CID 169438137) has the molecular formula C31H16Br6O7 and a molecular weight of 979.89 g/mol. Its IUPAC name is [2,6-dibromo-4-[2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]carbonylphenyl] 3,5-dibromo-4-hydroxybenzoate.
| Compound Name | [2,6-dibromo-4-[2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]carbonylphenyl] 3,5-dibromo-4-hydroxybenzoate |
|---|---|
| PubChem CID | 169438137 |
| Molecular Formula | C31H16Br6O7 |
| Molecular Weight | 979.89 g/mol |
| Exact Mass | 973.60 |
| IUPAC Name | [2,6-dibromo-4-[2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]carbonylphenyl] 3,5-dibromo-4-hydroxybenzoate |
| SMILES | CCc1oc2ccccc2c1C(=O)c1cc(Br)c(OC(=O)c2cc(Br)c(OC(=O)c3cc(Br)c(O)c(Br)c3)c(Br)c2)c(Br)c1 |
| InChI | InChI=1S/C31H16Br6O7/c1-2-23-25(16-5-3-4-6-24(16)42-23)26(38)13-7-19(34)28(20(35)8-13)43-31(41)15-11-21(36)29(22(37)12-15)44-30(40)14-9-17(32)27(39)18(33)10-14/h3-12,39H,2H2,1H3 |
| InChIKey | OEPAQQOVJXNEEE-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.89 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|