C19H14Br2O8 — CID 146659751
[2,6-dibromo-4-(2-ethyl-4,5,6,7-tetrahydroxy-1-benzofuran-3-carbonyl)phenyl] acetate (PubChem CID 146659751) has the molecular formula C19H14Br2O8 and a molecular weight of 530.12 g/mol. Its IUPAC name is [2,6-dibromo-4-(2-ethyl-4,5,6,7-tetrahydroxy-1-benzofuran-3-carbonyl)phenyl] acetate.
| Compound Name | [2,6-dibromo-4-(2-ethyl-4,5,6,7-tetrahydroxy-1-benzofuran-3-carbonyl)phenyl] acetate |
|---|---|
| PubChem CID | 146659751 |
| Molecular Formula | C19H14Br2O8 |
| Molecular Weight | 530.12 g/mol |
| Exact Mass | 527.91 |
| IUPAC Name | [2,6-dibromo-4-(2-ethyl-4,5,6,7-tetrahydroxy-1-benzofuran-3-carbonyl)phenyl] acetate |
| SMILES | CCc1oc2c(O)c(O)c(O)c(O)c2c1C(=O)c1cc(Br)c(OC(C)=O)c(Br)c1 |
| InChI | InChI=1S/C19H14Br2O8/c1-3-10-11(12-14(24)15(25)16(26)17(27)19(12)29-10)13(23)7-4-8(20)18(9(21)5-7)28-6(2)22/h4-5,24-27H,3H2,1-2H3 |
| InChIKey | YVKIIPSVCBHREW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.12 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|