C18H14Br2O8 — CID 155723305
(3,5-dibromo-4-hydroxyphenyl)-[4,5,7-trihydroxy-2-(2-hydroxyethyl)-6-methoxy-1-benzofuran-3-yl]methanone (PubChem CID 155723305) has the molecular formula C18H14Br2O8 and a molecular weight of 518.11 g/mol. Its IUPAC name is (3,5-dibromo-4-hydroxyphenyl)-[4,5,7-trihydroxy-2-(2-hydroxyethyl)-6-methoxy-1-benzofuran-3-yl]methanone.
| Compound Name | (3,5-dibromo-4-hydroxyphenyl)-[4,5,7-trihydroxy-2-(2-hydroxyethyl)-6-methoxy-1-benzofuran-3-yl]methanone |
|---|---|
| PubChem CID | 155723305 |
| Molecular Formula | C18H14Br2O8 |
| Molecular Weight | 518.11 g/mol |
| Exact Mass | 515.91 |
| IUPAC Name | (3,5-dibromo-4-hydroxyphenyl)-[4,5,7-trihydroxy-2-(2-hydroxyethyl)-6-methoxy-1-benzofuran-3-yl]methanone |
| SMILES | COc1c(O)c(O)c2c(C(=O)c3cc(Br)c(O)c(Br)c3)c(CCO)oc2c1O |
| InChI | InChI=1S/C18H14Br2O8/c1-27-18-15(25)14(24)11-10(9(2-3-21)28-17(11)16(18)26)12(22)6-4-7(19)13(23)8(20)5-6/h4-5,21,23-26H,2-3H2,1H3 |
| InChIKey | ADLLLXLRHMQPTC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.11 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|