C17H12Br2O4 — CID 169442050
(3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-ethyl-6-hydroxy-1-benzofuran-3-yl)methanone (PubChem CID 169442050) has the molecular formula C17H12Br2O4 and a molecular weight of 446.04 g/mol. Its IUPAC name is (3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-ethyl-6-hydroxy-1-benzofuran-3-yl)methanone.
| Compound Name | (3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-ethyl-6-hydroxy-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 169442050 |
| Molecular Formula | C17H12Br2O4 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | (3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-ethyl-6-hydroxy-1-benzofuran-3-yl)methanone |
| SMILES | CCc1oc2cc(O)ccc2c1C(=O)[13c]1[13cH][13c](Br)[13c](O)[13c](Br)[13cH]1 |
| InChI | InChI=1S/C17H12Br2O4/c1-2-13-15(10-4-3-9(20)7-14(10)23-13)16(21)8-5-11(18)17(22)12(19)6-8/h3-7,20,22H,2H2,1H3/i5+1,6+1,8+1,11+1,12+1,17+1 |
| InChIKey | FEXBXMFVRKZOOZ-VIKNPIARSA-N |
| XLogP | 5.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |