C18H14Br2O4 — CID 167562014
(3,5-dibromo-4-methylphenyl)-(4,7-dideuterio-2-ethyl-5,6-dihydroxy-1-benzofuran-3-yl)methanone (PubChem CID 167562014) has the molecular formula C18H14Br2O4 and a molecular weight of 456.13 g/mol. Its IUPAC name is (3,5-dibromo-4-methylphenyl)-(4,7-dideuterio-2-ethyl-5,6-dihydroxy-1-benzofuran-3-yl)methanone.
| Compound Name | (3,5-dibromo-4-methylphenyl)-(4,7-dideuterio-2-ethyl-5,6-dihydroxy-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 167562014 |
| Molecular Formula | C18H14Br2O4 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | (3,5-dibromo-4-methylphenyl)-(4,7-dideuterio-2-ethyl-5,6-dihydroxy-1-benzofuran-3-yl)methanone |
| SMILES | [2H]c1c(O)c(O)c([2H])c2c(C(=O)c3cc(Br)c(C)c(Br)c3)c(CC)oc12 |
| InChI | InChI=1S/C18H14Br2O4/c1-3-15-17(10-6-13(21)14(22)7-16(10)24-15)18(23)9-4-11(19)8(2)12(20)5-9/h4-7,21-22H,3H2,1-2H3/i6D,7D |
| InChIKey | SOFRQHQMDHLPHR-QFIQSOQBSA-N |
| XLogP | 5.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|