C17H12BrClO3 — CID 71512296
(3-bromo-4-hydroxyphenyl)-(5-chloro-2-ethyl-1-benzofuran-3-yl)methanone (PubChem CID 71512296) has the molecular formula C17H12BrClO3 and a molecular weight of 379.64 g/mol. Its IUPAC name is (3-bromo-4-hydroxyphenyl)-(5-chloro-2-ethyl-1-benzofuran-3-yl)methanone.
| Compound Name | (3-bromo-4-hydroxyphenyl)-(5-chloro-2-ethyl-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 71512296 |
| Molecular Formula | C17H12BrClO3 |
| Molecular Weight | 379.64 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | (3-bromo-4-hydroxyphenyl)-(5-chloro-2-ethyl-1-benzofuran-3-yl)methanone |
| SMILES | CCc1oc2ccc(Cl)cc2c1C(=O)c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C17H12BrClO3/c1-2-14-16(11-8-10(19)4-6-15(11)22-14)17(21)9-3-5-13(20)12(18)7-9/h3-8,20H,2H2,1H3 |
| InChIKey | SAOBRRHKGNRWKX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |