About 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium
3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium (PubChem CID 175473718) has the molecular formula C17H11Br2N2O3+
and a molecular weight of 451.09 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium.
Molecular Properties
| Compound Name | 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium |
| PubChem CID | 175473718 |
| Molecular Formula | C17H11Br2N2O3+ |
| Molecular Weight | 451.09 g/mol |
| Exact Mass | 448.91 |
| IUPAC Name | 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium |
| SMILES | CCc1oc2cc([N+]#N)ccc2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C17H10Br2N2O3/c1-2-13-15(10-4-3-9(21-20)7-14(10)24-13)16(22)8-5-11(18)17(23)12(19)6-8/h3-7H,2H2,1H3/p+1 |
| InChIKey | YDJZMULFBZDBPE-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.09 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium?
The IUPAC name of 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium (CID 175473718) is 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium.
What is the SMILES notation for 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium?
The canonical SMILES for 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium is CCc1oc2cc([N+]#N)ccc2c1C(=O)c1cc(Br)c(O)c(Br)c1.
What is the InChIKey of 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium?
The InChIKey is YDJZMULFBZDBPE-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H10Br2N2O3/c1-2-13-15(10-4-3-9(21-20)7-14(10)24-13)16(22)8-5-11(18)17(23)12(19)6-8/h3-7H,2H2,1H3/p+1.
What are the key properties of 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium?
3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium has a molecular weight of 451.09 g/mol, XLogP of 5.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-1-benzofuran-6-diazonium is sourced from PubChem (CID 175473718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).