C24H16Br2O6 — CID 157451259
[3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-5-hydroxy-1-benzofuran-6-yl] benzoate (PubChem CID 157451259) has the molecular formula C24H16Br2O6 and a molecular weight of 560.19 g/mol. Its IUPAC name is [3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-5-hydroxy-1-benzofuran-6-yl] benzoate.
| Compound Name | [3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-5-hydroxy-1-benzofuran-6-yl] benzoate |
|---|---|
| PubChem CID | 157451259 |
| Molecular Formula | C24H16Br2O6 |
| Molecular Weight | 560.19 g/mol |
| Exact Mass | 557.93 |
| IUPAC Name | [3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-5-hydroxy-1-benzofuran-6-yl] benzoate |
| SMILES | CCc1oc2cc(OC(=O)c3ccccc3)c(O)cc2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C24H16Br2O6/c1-2-18-21(22(28)13-8-15(25)23(29)16(26)9-13)14-10-17(27)20(11-19(14)31-18)32-24(30)12-6-4-3-5-7-12/h3-11,27,29H,2H2,1H3 |
| InChIKey | CQSDONGYSACBHD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.19 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|