C27H26N2O5 — CID 153349782
[3-(3,5-diaminobenzoyl)-5-hydroxy-2-pentyl-1-benzofuran-6-yl] benzoate (PubChem CID 153349782) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is [3-(3,5-diaminobenzoyl)-5-hydroxy-2-pentyl-1-benzofuran-6-yl] benzoate.
| Compound Name | [3-(3,5-diaminobenzoyl)-5-hydroxy-2-pentyl-1-benzofuran-6-yl] benzoate |
|---|---|
| PubChem CID | 153349782 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [3-(3,5-diaminobenzoyl)-5-hydroxy-2-pentyl-1-benzofuran-6-yl] benzoate |
| SMILES | CCCCCc1oc2cc(OC(=O)c3ccccc3)c(O)cc2c1C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C27H26N2O5/c1-2-3-5-10-22-25(26(31)17-11-18(28)13-19(29)12-17)20-14-21(30)24(15-23(20)33-22)34-27(32)16-8-6-4-7-9-16/h4,6-9,11-15,30H,2-3,5,10,28-29H2,1H3 |
| InChIKey | MDHIXTGISLCIAL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|