C25H21N3O5 — CID 153349801
[2-(3-amino-3-oxopropyl)-3-(3,5-diaminobenzoyl)-1-benzofuran-6-yl] benzoate (PubChem CID 153349801) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is [2-(3-amino-3-oxopropyl)-3-(3,5-diaminobenzoyl)-1-benzofuran-6-yl] benzoate.
| Compound Name | [2-(3-amino-3-oxopropyl)-3-(3,5-diaminobenzoyl)-1-benzofuran-6-yl] benzoate |
|---|---|
| PubChem CID | 153349801 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [2-(3-amino-3-oxopropyl)-3-(3,5-diaminobenzoyl)-1-benzofuran-6-yl] benzoate |
| SMILES | NC(=O)CCc1oc2cc(OC(=O)c3ccccc3)ccc2c1C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C25H21N3O5/c26-16-10-15(11-17(27)12-16)24(30)23-19-7-6-18(32-25(31)14-4-2-1-3-5-14)13-21(19)33-20(23)8-9-22(28)29/h1-7,10-13H,8-9,26-27H2,(H2,28,29) |
| InChIKey | NQVRYNJNMKRZQZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|