C16H10I2O3 — CID 10164183
(4-hydroxy-3,5-diiodophenyl)-(2-methyl-1-benzofuran-3-yl)methanone (PubChem CID 10164183) has the molecular formula C16H10I2O3 and a molecular weight of 504.06 g/mol. Its IUPAC name is (4-hydroxy-3,5-diiodophenyl)-(2-methyl-1-benzofuran-3-yl)methanone.
| Compound Name | (4-hydroxy-3,5-diiodophenyl)-(2-methyl-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 10164183 |
| Molecular Formula | C16H10I2O3 |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.87 |
| IUPAC Name | (4-hydroxy-3,5-diiodophenyl)-(2-methyl-1-benzofuran-3-yl)methanone |
| SMILES | Cc1oc2ccccc2c1C(=O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C16H10I2O3/c1-8-14(10-4-2-3-5-13(10)21-8)15(19)9-6-11(17)16(20)12(18)7-9/h2-7,20H,1H3 |
| InChIKey | QLUUKNMPBTWGBB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|