C38H36N2O4 — CID 101116773
(Z)-1-(2-ethyl-1-benzofuran-3-yl)-N-[(E)-[1-(2-ethyl-1-benzofuran-3-yl)-2-(4-methoxyphenyl)ethylidene]amino]-2-(4-methoxyphenyl)ethanimine (PubChem CID 101116773) has the molecular formula C38H36N2O4 and a molecular weight of 584.72 g/mol. Its IUPAC name is (Z)-1-(2-ethyl-1-benzofuran-3-yl)-N-[(E)-[1-(2-ethyl-1-benzofuran-3-yl)-2-(4-methoxyphenyl)ethylidene]amino]-2-(4-methoxyphenyl)ethanimine.
| Compound Name | (Z)-1-(2-ethyl-1-benzofuran-3-yl)-N-[(E)-[1-(2-ethyl-1-benzofuran-3-yl)-2-(4-methoxyphenyl)ethylidene]amino]-2-(4-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 101116773 |
| Molecular Formula | C38H36N2O4 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | (Z)-1-(2-ethyl-1-benzofuran-3-yl)-N-[(E)-[1-(2-ethyl-1-benzofuran-3-yl)-2-(4-methoxyphenyl)ethylidene]amino]-2-(4-methoxyphenyl)ethanimine |
| SMILES | CCc1oc2ccccc2c1/C(Cc1ccc(OC)cc1)=N\N=C(/Cc1ccc(OC)cc1)c1c(CC)oc2ccccc12 |
| InChI | InChI=1S/C38H36N2O4/c1-5-33-37(29-11-7-9-13-35(29)43-33)31(23-25-15-19-27(41-3)20-16-25)39-40-32(24-26-17-21-28(42-4)22-18-26)38-30-12-8-10-14-36(30)44-34(38)6-2/h7-22H,5-6,23-24H2,1-4H3/b39-31-,40-32+ |
| InChIKey | HWKHUBOJKHFQAU-PIXQJZRNSA-N |
| XLogP | 9.00 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|