C23H26O2 — CID 142970496
2-ethyl-3-[(E)-2-[(4-methoxyphenyl)methyl]but-1-enyl]-5-methyl-1-benzofuran (PubChem CID 142970496) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-ethyl-3-[(E)-2-[(4-methoxyphenyl)methyl]but-1-enyl]-5-methyl-1-benzofuran.
| Compound Name | 2-ethyl-3-[(E)-2-[(4-methoxyphenyl)methyl]but-1-enyl]-5-methyl-1-benzofuran |
|---|---|
| PubChem CID | 142970496 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-ethyl-3-[(E)-2-[(4-methoxyphenyl)methyl]but-1-enyl]-5-methyl-1-benzofuran |
| SMILES | CC/C(=C\c1c(CC)oc2ccc(C)cc12)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H26O2/c1-5-17(14-18-8-10-19(24-4)11-9-18)15-21-20-13-16(3)7-12-23(20)25-22(21)6-2/h7-13,15H,5-6,14H2,1-4H3/b17-15+ |
| InChIKey | LKSSRVAWNAFDPL-BMRADRMJSA-N |
| XLogP | 6.35 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |