C13H13NO2 — CID 47120041
(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide (PubChem CID 47120041) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47120041 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(N)=O |
| InChI | InChI=1S/C13H13NO2/c1-2-11-10(7-8-13(14)15)9-5-3-4-6-12(9)16-11/h3-8H,2H2,1H3,(H2,14,15)/b8-7+ |
| InChIKey | AICBOVONJFXVKO-BQYQJAHWSA-N |
| XLogP | 2.49 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|