C17H17F3N2O3 — CID 94131112
(E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide (PubChem CID 94131112) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is (E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 94131112 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]prop-2-enamide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O3/c1-2-13-12(11-5-3-4-6-14(11)25-13)7-8-15(23)21-9-16(24)22-10-17(18,19)20/h3-8H,2,9-10H2,1H3,(H,21,23)(H,22,24)/b8-7+ |
| InChIKey | AWEFKXGYBWEZKV-BQYQJAHWSA-N |
| XLogP | 2.80 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|