C22H23NO4S — CID 51247281
(E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide (PubChem CID 51247281) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is (E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 51247281 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (E)-3-(2-ethyl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)NC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-4-20-19(18-7-5-6-8-21(18)27-20)13-14-22(24)23-15(2)16-9-11-17(12-10-16)28(3,25)26/h5-15H,4H2,1-3H3,(H,23,24)/b14-13+ |
| InChIKey | BUEOZWAEZAJPEB-BUHFOSPRSA-N |
| XLogP | 4.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|