C19H19N3O2 — CID 51250724
(E)-N,N-bis(2-cyanoethyl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide (PubChem CID 51250724) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-N,N-bis(2-cyanoethyl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide.
| Compound Name | (E)-N,N-bis(2-cyanoethyl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51250724 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (E)-N,N-bis(2-cyanoethyl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enamide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C19H19N3O2/c1-2-17-16(15-7-3-4-8-18(15)24-17)9-10-19(23)22(13-5-11-20)14-6-12-21/h3-4,7-10H,2,5-6,13-14H2,1H3/b10-9+ |
| InChIKey | BGRRIWFGMXDFOQ-MDZDMXLPSA-N |
| XLogP | 3.66 |
| TPSA | 81.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|