C15H11F2N3O2 — CID 145028312
2-fluoro-1-(2-fluoro-4-hydroxyphenyl)-N'-hydroxyindole-3-carboximidamide (PubChem CID 145028312) has the molecular formula C15H11F2N3O2 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-fluoro-1-(2-fluoro-4-hydroxyphenyl)-N'-hydroxyindole-3-carboximidamide.
| Compound Name | 2-fluoro-1-(2-fluoro-4-hydroxyphenyl)-N'-hydroxyindole-3-carboximidamide |
|---|---|
| PubChem CID | 145028312 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-fluoro-1-(2-fluoro-4-hydroxyphenyl)-N'-hydroxyindole-3-carboximidamide |
| SMILES | NC(=NO)c1c(F)n(-c2ccc(O)cc2F)c2ccccc12 |
| InChI | InChI=1S/C15H11F2N3O2/c16-10-7-8(21)5-6-12(10)20-11-4-2-1-3-9(11)13(14(20)17)15(18)19-22/h1-7,21-22H,(H2,18,19) |
| InChIKey | BFWXILSTQAEPRF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|