C19H10F4N4O — CID 66898006
1-(2-fluoro-4-hydroxyphenyl)-2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]indole-3-carbonitrile (PubChem CID 66898006) has the molecular formula C19H10F4N4O and a molecular weight of 386.31 g/mol. Its IUPAC name is 1-(2-fluoro-4-hydroxyphenyl)-2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]indole-3-carbonitrile.
| Compound Name | 1-(2-fluoro-4-hydroxyphenyl)-2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]indole-3-carbonitrile |
|---|---|
| PubChem CID | 66898006 |
| Molecular Formula | C19H10F4N4O |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-(2-fluoro-4-hydroxyphenyl)-2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]indole-3-carbonitrile |
| SMILES | N#Cc1c(-c2cn[nH]c2C(F)(F)F)n(-c2ccc(O)cc2F)c2ccccc12 |
| InChI | InChI=1S/C19H10F4N4O/c20-14-7-10(28)5-6-16(14)27-15-4-2-1-3-11(15)12(8-24)17(27)13-9-25-26-18(13)19(21,22)23/h1-7,9,28H,(H,25,26) |
| InChIKey | VCKBPBIWRCWKIO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |