C19H9F3N2 — CID 146406018
2-carbazol-9-yl-3,5,6-trifluorobenzonitrile (PubChem CID 146406018) has the molecular formula C19H9F3N2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 2-carbazol-9-yl-3,5,6-trifluorobenzonitrile.
| Compound Name | 2-carbazol-9-yl-3,5,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 146406018 |
| Molecular Formula | C19H9F3N2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-carbazol-9-yl-3,5,6-trifluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)cc(F)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C19H9F3N2/c20-14-9-15(21)19(13(10-23)18(14)22)24-16-7-3-1-5-11(16)12-6-2-4-8-17(12)24/h1-9H |
| InChIKey | SJZXWXJMAUXKGP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|