C32H17FN4 — CID 140701568
4,6-di(carbazol-9-yl)-2-fluoro-3-isocyanobenzonitrile (PubChem CID 140701568) has the molecular formula C32H17FN4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 4,6-di(carbazol-9-yl)-2-fluoro-3-isocyanobenzonitrile.
| Compound Name | 4,6-di(carbazol-9-yl)-2-fluoro-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140701568 |
| Molecular Formula | C32H17FN4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 4,6-di(carbazol-9-yl)-2-fluoro-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccccc3c3ccccc32)cc(-n2c3ccccc3c3ccccc32)c(C#N)c1F |
| InChI | InChI=1S/C32H17FN4/c1-35-32-30(37-27-16-8-4-12-22(27)23-13-5-9-17-28(23)37)18-29(24(19-34)31(32)33)36-25-14-6-2-10-20(25)21-11-3-7-15-26(21)36/h2-18H |
| InChIKey | IYEWAZGZXPRUHP-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|