C25H12F4N2 — CID 139507239
4-(2-carbazol-9-ylphenyl)-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 139507239) has the molecular formula C25H12F4N2 and a molecular weight of 416.38 g/mol. Its IUPAC name is 4-(2-carbazol-9-ylphenyl)-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-(2-carbazol-9-ylphenyl)-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 139507239 |
| Molecular Formula | C25H12F4N2 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-(2-carbazol-9-ylphenyl)-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(-c2ccccc2-n2c3ccccc3c3ccccc32)c(F)c1F |
| InChI | InChI=1S/C25H12F4N2/c26-22-17(13-30)23(27)25(29)21(24(22)28)16-9-3-6-12-20(16)31-18-10-4-1-7-14(18)15-8-2-5-11-19(15)31/h1-12H |
| InChIKey | PCVCNPPRYPLZAD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|