C37H36O4 — CID 142305622
4-[[2,4-dihydroxy-3,5-bis(prop-2-enyl)phenyl]-(4-phenylphenyl)methyl]-2,6-bis(prop-2-enyl)benzene-1,3-diol (PubChem CID 142305622) has the molecular formula C37H36O4 and a molecular weight of 544.69 g/mol. Its IUPAC name is 4-[[2,4-dihydroxy-3,5-bis(prop-2-enyl)phenyl]-(4-phenylphenyl)methyl]-2,6-bis(prop-2-enyl)benzene-1,3-diol.
| Compound Name | 4-[[2,4-dihydroxy-3,5-bis(prop-2-enyl)phenyl]-(4-phenylphenyl)methyl]-2,6-bis(prop-2-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 142305622 |
| Molecular Formula | C37H36O4 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 4-[[2,4-dihydroxy-3,5-bis(prop-2-enyl)phenyl]-(4-phenylphenyl)methyl]-2,6-bis(prop-2-enyl)benzene-1,3-diol |
| SMILES | C=CCc1cc(C(c2ccc(-c3ccccc3)cc2)c2cc(CC=C)c(O)c(CC=C)c2O)c(O)c(CC=C)c1O |
| InChI | InChI=1S/C37H36O4/c1-5-12-27-22-31(36(40)29(14-7-3)34(27)38)33(26-20-18-25(19-21-26)24-16-10-9-11-17-24)32-23-28(13-6-2)35(39)30(15-8-4)37(32)41/h5-11,16-23,33,38-41H,1-4,12-15H2 |
| InChIKey | DTHOITAPRXRIHG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|