C19H20N2O2 — CID 56620005
3-(phenyldiazenylmethyl)-2,5-bis(prop-2-enyl)benzene-1,4-diol (PubChem CID 56620005) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-(phenyldiazenylmethyl)-2,5-bis(prop-2-enyl)benzene-1,4-diol.
| Compound Name | 3-(phenyldiazenylmethyl)-2,5-bis(prop-2-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 56620005 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-(phenyldiazenylmethyl)-2,5-bis(prop-2-enyl)benzene-1,4-diol |
| SMILES | C=CCc1cc(O)c(CC=C)c(C/N=N/c2ccccc2)c1O |
| InChI | InChI=1S/C19H20N2O2/c1-3-8-14-12-18(22)16(9-4-2)17(19(14)23)13-20-21-15-10-6-5-7-11-15/h3-7,10-12,22-23H,1-2,8-9,13H2/b21-20+ |
| InChIKey | IEFSBHWWTJBAKQ-QZQOTICOSA-N |
| XLogP | 4.84 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|