C19H19N3O4 — CID 56620957
3-[[(4-nitrophenyl)diazenyl]methyl]-2,5-bis(prop-2-enyl)benzene-1,4-diol (PubChem CID 56620957) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-[[(4-nitrophenyl)diazenyl]methyl]-2,5-bis(prop-2-enyl)benzene-1,4-diol.
| Compound Name | 3-[[(4-nitrophenyl)diazenyl]methyl]-2,5-bis(prop-2-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 56620957 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-[[(4-nitrophenyl)diazenyl]methyl]-2,5-bis(prop-2-enyl)benzene-1,4-diol |
| SMILES | C=CCc1cc(O)c(CC=C)c(C/N=N/c2ccc([N+](=O)[O-])cc2)c1O |
| InChI | InChI=1S/C19H19N3O4/c1-3-5-13-11-18(23)16(6-4-2)17(19(13)24)12-20-21-14-7-9-15(10-8-14)22(25)26/h3-4,7-11,23-24H,1-2,5-6,12H2/b21-20+ |
| InChIKey | ROWVKPQLTSXDRF-QZQOTICOSA-N |
| XLogP | 4.75 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|