C12H14ClFN2 — CID 175395544
[3-chloro-2-fluoro-5,6-bis(prop-2-enyl)phenyl]hydrazine (PubChem CID 175395544) has the molecular formula C12H14ClFN2 and a molecular weight of 240.71 g/mol. Its IUPAC name is [3-chloro-2-fluoro-5,6-bis(prop-2-enyl)phenyl]hydrazine.
| Compound Name | [3-chloro-2-fluoro-5,6-bis(prop-2-enyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 175395544 |
| Molecular Formula | C12H14ClFN2 |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | [3-chloro-2-fluoro-5,6-bis(prop-2-enyl)phenyl]hydrazine |
| SMILES | C=CCc1cc(Cl)c(F)c(NN)c1CC=C |
| InChI | InChI=1S/C12H14ClFN2/c1-3-5-8-7-10(13)11(14)12(16-15)9(8)6-4-2/h3-4,7,16H,1-2,5-6,15H2 |
| InChIKey | AHHWIKTWUJHGBL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|