C9H6F4 — CID 12944006
1,2,4,5-tetrafluoro-3-prop-2-enylbenzene (PubChem CID 12944006) has the molecular formula C9H6F4 and a molecular weight of 190.14 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-prop-2-enylbenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 12944006 |
| Molecular Formula | C9H6F4 |
| Molecular Weight | 190.14 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-prop-2-enylbenzene |
| SMILES | C=CCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H6F4/c1-2-3-5-8(12)6(10)4-7(11)9(5)13/h2,4H,1,3H2 |
| InChIKey | GPRHTRPPPWZVSG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|