About azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene
azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene (PubChem CID 130386839) has the molecular formula C13H18ClN
and a molecular weight of 223.75 g/mol. Its IUPAC name is azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene.
Molecular Properties
| Compound Name | azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene |
| PubChem CID | 130386839 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene |
| SMILES | C=CCc1cccc(CCl)c1CC=C.N |
| InChI | InChI=1S/C13H15Cl.H3N/c1-3-6-11-8-5-9-12(10-14)13(11)7-4-2;/h3-5,8-9H,1-2,6-7,10H2;1H3 |
| InChIKey | UEGNOZHJOOMZCC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene?
The IUPAC name of azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene (CID 130386839) is azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene.
What is the SMILES notation for azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene?
The canonical SMILES for azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene is C=CCc1cccc(CCl)c1CC=C.N.
What is the InChIKey of azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene?
The InChIKey is UEGNOZHJOOMZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl.H3N/c1-3-6-11-8-5-9-12(10-14)13(11)7-4-2;/h3-5,8-9H,1-2,6-7,10H2;1H3.
What are the key properties of azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene?
azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene has a molecular weight of 223.75 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene is sourced from PubChem (CID 130386839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).