C13H18ClN — CID 130386839
azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene (PubChem CID 130386839) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene.
| Compound Name | azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene |
|---|---|
| PubChem CID | 130386839 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | azane;1-(chloromethyl)-2,3-bis(prop-2-enyl)benzene |
| SMILES | C=CCc1cccc(CCl)c1CC=C.N |
| InChI | InChI=1S/C13H15Cl.H3N/c1-3-6-11-8-5-9-12(10-14)13(11)7-4-2;/h3-5,8-9H,1-2,6-7,10H2;1H3 |
| InChIKey | UEGNOZHJOOMZCC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|