C33H35O3P — CID 66971419
bis[2,3-bis(prop-2-enyl)phenyl] (2-prop-2-enylphenyl) phosphite (PubChem CID 66971419) has the molecular formula C33H35O3P and a molecular weight of 510.61 g/mol. Its IUPAC name is bis[2,3-bis(prop-2-enyl)phenyl] (2-prop-2-enylphenyl) phosphite.
| Compound Name | bis[2,3-bis(prop-2-enyl)phenyl] (2-prop-2-enylphenyl) phosphite |
|---|---|
| PubChem CID | 66971419 |
| Molecular Formula | C33H35O3P |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | bis[2,3-bis(prop-2-enyl)phenyl] (2-prop-2-enylphenyl) phosphite |
| SMILES | C=CCc1ccccc1OP(Oc1cccc(CC=C)c1CC=C)Oc1cccc(CC=C)c1CC=C |
| InChI | InChI=1S/C33H35O3P/c1-6-15-26-21-13-24-32(29(26)18-9-4)35-37(34-31-23-12-11-20-28(31)17-8-3)36-33-25-14-22-27(16-7-2)30(33)19-10-5/h6-14,20-25H,1-5,15-19H2 |
| InChIKey | FZMMSQZJHWESTB-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|