molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene

C15H14N2O — CID 70452460

IUPACmolecular nitrogen;1-phenoxy-2-prop-2-enylbenzene
SMILESC=CCc1ccccc1Oc1ccccc1.N#N
InChIInChI=1S/C15H14O.N2/c1-2-8-13-9-6-7-12-15(13)16-14-10-4-3-5-11-14;1-2/h2-7,9-12H,1,8H2;
InChIKeyHCXQDGCZOUQILG-UHFFFAOYSA-N
MW238.29 g/mol
LogP4.24
Rot. Bonds4

About molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene

molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene (PubChem CID 70452460) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene.

Molecular Properties

Compound Namemolecular nitrogen;1-phenoxy-2-prop-2-enylbenzene
PubChem CID70452460
Molecular FormulaC15H14N2O
Molecular Weight238.29 g/mol
Exact Mass238.11
IUPAC Namemolecular nitrogen;1-phenoxy-2-prop-2-enylbenzene
SMILESC=CCc1ccccc1Oc1ccccc1.N#N
InChIInChI=1S/C15H14O.N2/c1-2-8-13-9-6-7-12-15(13)16-14-10-4-3-5-11-14;1-2/h2-7,9-12H,1,8H2;
InChIKeyHCXQDGCZOUQILG-UHFFFAOYSA-N
XLogP4.24
TPSA56.81 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.29
LogP ≤ 54.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene?
The IUPAC name of molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene (CID 70452460) is molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene.
What is the SMILES notation for molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene?
The canonical SMILES for molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene is C=CCc1ccccc1Oc1ccccc1.N#N.
What is the InChIKey of molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene?
The InChIKey is HCXQDGCZOUQILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.N2/c1-2-8-13-9-6-7-12-15(13)16-14-10-4-3-5-11-14;1-2/h2-7,9-12H,1,8H2;.
What are the key properties of molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene?
molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene has a molecular weight of 238.29 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular nitrogen;1-phenoxy-2-prop-2-enylbenzene is sourced from PubChem (CID 70452460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).